EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44N6O11S |
| Net Charge | 0 |
| Average Mass | 732.813 |
| Monoisotopic Mass | 732.27888 |
| SMILES | N=C(N)N1CCC[C@@H](NC(=O)C2CC3CCC(O)CC3N2C(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)[C@H](O)Cc2ccc(OS(=O)(=O)O)cc2)C1O |
| InChI | InChI=1S/C33H44N6O11S/c34-33(35)38-13-1-2-24(31(38)45)36-29(43)27-16-20-7-10-22(41)17-26(20)39(27)32(46)25(14-18-3-8-21(40)9-4-18)37-30(44)28(42)15-19-5-11-23(12-6-19)50-51(47,48)49/h3-6,8-9,11-12,20,22,24-28,31,40-42,45H,1-2,7,10,13-17H2,(H3,34,35)(H,36,43)(H,37,44)(H,47,48,49)/t20?,22?,24-,25-,26?,27?,28-,31?/m1/s1 |
| InChIKey | GIQUSRUOIKSAJD-PEBUMYOCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | DOI (10.1016/0040-4020(96)00890-3) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosin 102 B (CHEBI:198928) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| [4-[(2R)-3-[[(2R)-1-[2-[[(3R)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]carbamoyl]-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-2-hydroxy-3-oxopropyl]phenyl] hydrogen sulate |
| Manual Xrefs | Databases |
|---|---|
| 8277005 | ChemSpider |