EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O5 |
| Net Charge | 0 |
| Average Mass | 196.158 |
| Monoisotopic Mass | 196.03717 |
| SMILES | O=C(O)C(=O)Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H8O5/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,10-11H,4H2,(H,13,14) |
| InChIKey | LQQFFJFGLSKYIR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dihydroxyphenylpyruvic acid (CHEBI:19891) has functional parent pyruvic acid (CHEBI:32816) |
| 3,4-dihydroxyphenylpyruvic acid (CHEBI:19891) has role metabolite (CHEBI:25212) |
| 3,4-dihydroxyphenylpyruvic acid (CHEBI:19891) is a 2-oxo monocarboxylic acid (CHEBI:35910) |
| 3,4-dihydroxyphenylpyruvic acid (CHEBI:19891) is conjugate acid of 3,4-dihydroxyphenylpyruvate (CHEBI:29055) |
| Incoming Relation(s) |
| vanilpyruvic acid (CHEBI:88402) has functional parent 3,4-dihydroxyphenylpyruvic acid (CHEBI:19891) |
| 3,4-dihydroxyphenylpyruvate (CHEBI:29055) is conjugate base of 3,4-dihydroxyphenylpyruvic acid (CHEBI:19891) |
| IUPAC Name |
|---|
| 3-(3,4-dihydroxyphenyl)-2-oxopropanoic acid |
| Synonyms | Source |
|---|---|
| 3,4-Dihydroxyphenylpyruvate | KEGG COMPOUND |
| 3,4-dihydroxy-α-oxobenzenepropanoic acid | ChemIDplus |
| DHPPA | ChemIDplus |
| Citations |
|---|