EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19NO3 |
| Net Charge | 0 |
| Average Mass | 201.266 |
| Monoisotopic Mass | 201.13649 |
| SMILES | C[C@H](N)C(=O)CCCC[C@@H](C)C(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-7(10(13)14)5-3-4-6-9(12)8(2)11/h7-8H,3-6,11H2,1-2H3,(H,13,14)/t7-,8+/m1/s1 |
| InChIKey | YBWPFLPQZXWNNM-SFYZADRCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces diastaticus (ncbitaxon:1956) | - | PubMed (8904845) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8(S)-amino-2(R)-methyl-7-oxononanoic acid (CHEBI:198908) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2R,8S)-8-amino-2-methyl-7-oxononanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 154431 | ChemSpider |