EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23N7O6 |
| Net Charge | 0 |
| Average Mass | 457.447 |
| Monoisotopic Mass | 457.17098 |
| SMILES | [H][C@]12CNc3nc(N)nc(=O)c3N1CN(c1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)O)cc1)C2 |
| InChI | InChI=1S/C20H23N7O6/c21-20-24-16-15(18(31)25-20)27-9-26(8-12(27)7-22-16)11-3-1-10(2-4-11)17(30)23-13(19(32)33)5-6-14(28)29/h1-4,12-13H,5-9H2,(H,23,30)(H,28,29)(H,32,33)(H4,21,22,24,25,31)/t12-,13+/m1/s1 |
| InChIKey | QYNUQALWYRSVHF-OLZOCXBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (6R)-5,10-methylenetetrahydrofolic acid (CHEBI:1989) has role Escherichia coli metabolite (CHEBI:76971) |
| (6R)-5,10-methylenetetrahydrofolic acid (CHEBI:1989) has role cofactor (CHEBI:23357) |
| (6R)-5,10-methylenetetrahydrofolic acid (CHEBI:1989) has role mouse metabolite (CHEBI:75771) |
| (6R)-5,10-methylenetetrahydrofolic acid (CHEBI:1989) is a 5,10-methylenetetrahydrofolic acid (CHEBI:20502) |
| (6R)-5,10-methylenetetrahydrofolic acid (CHEBI:1989) is conjugate acid of (6R)-5,10-methylenetetrahydrofolate(2−) (CHEBI:15636) |
| Incoming Relation(s) |
| (6R)-5,10-methenyltetrahydrofolic acid (CHEBI:15638) has functional parent (6R)-5,10-methylenetetrahydrofolic acid (CHEBI:1989) |
| 5,10-methylenetetrahydrofolate heptaglutamate (CHEBI:60976) has functional parent (6R)-5,10-methylenetetrahydrofolic acid (CHEBI:1989) |
| (6R)-5,10-methylenetetrahydrofolate(2−) (CHEBI:15636) is conjugate base of (6R)-5,10-methylenetetrahydrofolic acid (CHEBI:1989) |
| IUPAC Name |
|---|
| N-{4-[(6aR)-3-amino-1-oxo-1,2,5,6,6a,7-hexahydroimidazo[1,5-f]pteridin-8(9H)-yl]benzoyl}-L-glutamic acid |
| Synonyms | Source |
|---|---|
| 5,10-Methylenetetrahydrofolate | KEGG COMPOUND |
| 5,10-methylenetetrahydrofolic acid | ChemIDplus |
| 5,10-Methylene-THF | KEGG COMPOUND |
| (6R)-5,10-Methylenetetrahydrofolate | KEGG COMPOUND |