EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O5 |
| Net Charge | 0 |
| Average Mass | 196.158 |
| Monoisotopic Mass | 196.03717 |
| SMILES | COc1cc2c(c(O)c1O)COC2=O |
| InChI | InChI=1S/C9H8O5/c1-13-6-2-4-5(3-14-9(4)12)7(10)8(6)11/h2,10-11H,3H2,1H3 |
| InChIKey | LVGUYWAAEWFTQZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sparassis crispa (ncbitaxon:139825) | - | PubMed (20686231) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hanabiratakelide A (CHEBI:198872) is a trihydroxybenzoic acid (CHEBI:27115) |
| IUPAC Name |
|---|
| 4,5-dihydroxy-6-methoxy-3H-2-benzouran-1-one |
| Manual Xrefs | Databases |
|---|---|
| 28287866 | ChemSpider |