EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO5 |
| Net Charge | 0 |
| Average Mass | 237.211 |
| Monoisotopic Mass | 237.06372 |
| SMILES | COC(=O)/C(=C/c1ccc(O)c(O)c1)NC=O |
| InChI | InChI=1S/C11H11NO5/c1-17-11(16)8(12-6-13)4-7-2-3-9(14)10(15)5-7/h2-6,14-15H,1H3,(H,12,13)/b8-4- |
| InChIKey | FHRYFVKKDRFMLY-YWEYNIOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (26670415) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl (Z)-3-(3,4-dihydroxyphenyl)-2-formamidoacrylate (CHEBI:198828) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| methyl (Z)-3-(3,4-dihydroxyphenyl)-2-ormamidoprop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 44210935 | ChemSpider |