EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12N2O2S |
| Net Charge | 0 |
| Average Mass | 248.307 |
| Monoisotopic Mass | 248.06195 |
| SMILES | CNc1ccccc1-c1nc(C(=O)OC)cs1 |
| InChI | InChI=1S/C12H12N2O2S/c1-13-9-6-4-3-5-8(9)11-14-10(7-17-11)12(15)16-2/h3-7,13H,1-2H3 |
| InChIKey | GADWTAUYJRJWRT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomycetospora (ncbitaxon:402649) | - | PubMed (25455147) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Anithiactin A (CHEBI:198821) is a aromatic carboxylic acid (CHEBI:33859) |
| Anithiactin A (CHEBI:198821) is a thiazoles (CHEBI:48901) |
| IUPAC Name |
|---|
| methyl 2-[2-(methylamino)phenyl]-1,3-thiazole-4-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 34981156 | ChemSpider |