EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N7O4 |
| Net Charge | 0 |
| Average Mass | 365.394 |
| Monoisotopic Mass | 365.18115 |
| SMILES | NC(N)=NC[C@@H](CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O)N=C(N)N |
| InChI | InChI=1S/C15H23N7O4/c16-14(17)20-7-9(21-15(18)19)6-12(24)22-11(13(25)26)5-8-1-3-10(23)4-2-8/h1-4,9,11,23H,5-7H2,(H,22,24)(H,25,26)(H4,16,17,20)(H4,18,19,21)/t9-,11+/m1/s1 |
| InChIKey | MJEHEKVGSWGBJB-KOLCDFICSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Isaria japonica (ncbitaxon:72233) | - | DOI (10.1016/j.tet.2009.06.069) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3,4-diguanidinobutanoyl-(S)-tyrosine (CHEBI:198797) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(3R)-3,4-bis(diaminomethylideneamino)butanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78436405 | ChemSpider |