EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30Cl2N2O8S2 |
| Net Charge | 0 |
| Average Mass | 609.550 |
| Monoisotopic Mass | 608.08206 |
| SMILES | CCC(C)(O)C1OC(=O)C(C)C(CCCC(C)(Cl)Cl)OC(=O)c2csc(n2)C(O)COC(=O)c2csc1n2 |
| InChI | InChI=1S/C24H30Cl2N2O8S2/c1-5-23(3,33)17-19-28-13(10-38-19)21(31)34-9-15(29)18-27-14(11-37-18)22(32)35-16(12(2)20(30)36-17)7-6-8-24(4,25)26/h10-12,15-17,29,33H,5-9H2,1-4H3 |
| InChIKey | OVRPLXYGNATYDY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | DOI (10.1016/s0040-4020(02)00895-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lyngbyabellin C (CHEBI:198778) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 12-(4,4-dichloropentyl)-5-hydroxy-16-(2-hydroxybutan-2-yl)-13-methyl-3,11,15-trioxa-7,18-dithia-20,21-diazatricyclo[15.2.1.16,9]henicosa-1(19),6(21),8,17(20)-tetraene-2,10,14-trione |
| Manual Xrefs | Databases |
|---|---|
| 9257758 | ChemSpider |