EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29NO11 |
| Net Charge | 0 |
| Average Mass | 543.525 |
| Monoisotopic Mass | 543.17406 |
| SMILES | COC(=O)[C@@H]1c2c(O)c3c(c(O)c2[C@@H](OC2CC(N)C(O)C(C)O2)C[C@@]1(C)O)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C27H29NO11/c1-9-21(30)11(28)7-14(38-9)39-13-8-27(2,36)20(26(35)37-3)17-16(13)24(33)19-18(25(17)34)22(31)10-5-4-6-12(29)15(10)23(19)32/h4-6,9,11,13-14,20-21,29-30,33-34,36H,7-8,28H2,1-3H3/t9?,11?,13-,14?,20-,21?,27+/m0/s1 |
| InChIKey | CPJDZTLLDPHJGM-ZDDZLPDHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8436560) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-788-15 (CHEBI:198752) is a anthracycline (CHEBI:48120) |
| IUPAC Name |
|---|
| methyl (1R,2R,4S)-4-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-2,5,7,12-tetrahydroxy-2-methyl-6,11-dioxo-3,4-dihydro-1H-tetracene-1-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78443727 | ChemSpider |