EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27N3O3 |
| Net Charge | 0 |
| Average Mass | 381.476 |
| Monoisotopic Mass | 381.20524 |
| SMILES | COC(=O)C(NC(=O)[C@@H]1C=C2c3cccc4ncc(c34)C[C@H]2N(C)C1)C(C)C |
| InChI | InChI=1S/C22H27N3O3/c1-12(2)20(22(27)28-4)24-21(26)14-8-16-15-6-5-7-17-19(15)13(10-23-17)9-18(16)25(3)11-14/h5-8,10,12,14,18,20,23H,9,11H2,1-4H3,(H,24,26)/t14-,18-,20?/m1/s1 |
| InChIKey | PUSHWZUNZAQTHW-GNTSEGDPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clavicepsspecies (ncbitaxon:2011970) | - | PubMed (14084049) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lysergyl-L-valyl methyl ester (CHEBI:198709) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl 2-[[(6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-g]quinoline-9-carbonyl]amino]-3-methylbutanoate |
| Manual Xrefs | Databases |
|---|---|
| 78439920 | ChemSpider |