EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO |
| Net Charge | 0 |
| Average Mass | 161.204 |
| Monoisotopic Mass | 161.08406 |
| SMILES | C/C=C1/C(=O)C=C2NCCC=C21 |
| InChI | InChI=1S/C10H11NO/c1-2-7-8-4-3-5-11-9(8)6-10(7)12/h2,4,6,11H,3,5H2,1H3/b7-2+ |
| InChIKey | RLVWTWCDRCCHFP-FARCUNLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (11000031) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptazone B2 (CHEBI:198702) is a enamine (CHEBI:47989) |
| Streptazone B2 (CHEBI:198702) is a enone (CHEBI:51689) |
| IUPAC Name |
|---|
| (5E)-5-ethylidene-2,3-dihydro-1H-cyclopenta[b]pyridin-6-one |
| Manual Xrefs | Databases |
|---|---|
| 8640020 | ChemSpider |