EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H36O4 |
| Net Charge | 0 |
| Average Mass | 412.570 |
| Monoisotopic Mass | 412.26136 |
| SMILES | CC[C@@H](C)[C@H]1O[C@]1(C)[C@]1(O)C(C)=C[C@@H]2CC(C)=CC[C@H]2[C@@H]1/C=C/C=C/C=C/C(=O)O |
| InChI | InChI=1S/C26H36O4/c1-6-18(3)24-25(5,30-24)26(29)19(4)16-20-15-17(2)13-14-21(20)22(26)11-9-7-8-10-12-23(27)28/h7-13,16,18,20-22,24,29H,6,14-15H2,1-5H3,(H,27,28)/b8-7+,11-9+,12-10+/t18-,20+,21-,22+,24-,25+,26+/m1/s1 |
| InChIKey | UMJNSMGAKMOMGN-UCGSJFBRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladobotryumspecies (ncbitaxon:2040732) | - | PubMed (16408955) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cladobotric acid A (CHEBI:198671) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,6E)-7-[(1S,2R,4aR,8aR)-2-[(2S,3R)-3-[(2R)-butan-2-yl]-2-methyloxiran-2-yl]-2-hydroxy-3,6-dimethyl-4a,5,8,8a-tetrahydro-1H-naphthalen-1-yl]hepta-2,4,6-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9843482 | ChemSpider |