EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38Cl2N4O7S2 |
| Net Charge | 0 |
| Average Mass | 677.673 |
| Monoisotopic Mass | 676.15590 |
| SMILES | CC(C)[C@@H]1NC(=O)CNC(=O)c2csc(n2)[C@H](C(C)(C)O)OC(=O)C(C)(C)[C@H](CCCC(C)(Cl)Cl)OC(=O)c2csc1n2 |
| InChI | InChI=1S/C28H38Cl2N4O7S2/c1-14(2)19-22-33-16(13-42-22)24(37)40-17(9-8-10-28(7,29)30)26(3,4)25(38)41-20(27(5,6)39)23-32-15(12-43-23)21(36)31-11-18(35)34-19/h12-14,17,19-20,39H,8-11H2,1-7H3,(H,31,36)(H,34,35)/t17-,19-,20+/m0/s1 |
| InChIKey | AFYNXSMIBRNBEB-YSIASYRMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (11076574) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lyngbyabellin B (CHEBI:198635) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (7S,14S,18S)-14-(4,4-dichloropentyl)-18-(2-hydroxypropan-2-yl)-15,15-dimethyl-7-propan-2-yl-13,17-dioxa-9,20-dithia-3,6,22,23-tetrazatricyclo[17.2.1.18,11]tricosa-1(21),8(23),10,19(22)-tetraene-2,5,12,16-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 78439585 | ChemSpider |