EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H17ClO5 |
| Net Charge | 0 |
| Average Mass | 348.782 |
| Monoisotopic Mass | 348.07645 |
| SMILES | C[C@@H]1C/C=C/Cc2ccc(o2)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H17ClO5/c1-10-4-2-3-5-11-6-7-12(24-11)8-13-16(18(22)23-10)14(20)9-15(21)17(13)19/h2-3,6-7,9-10,20-21H,4-5,8H2,1H3/b3-2+/t10-/m1/s1 |
| InChIKey | FMTPUVKFUGIZNF-VMZHVLLKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pochonia (ncbitaxon:243023) | - | DOI (10.1016/j.tetlet.2008.10.099) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pochonin H (CHEBI:198591) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (11R,13E)-4-chloro-5,7-dihydroxy-11-methyl-10,19-dioxatricyclo[14.2.1.03,8]nonadeca-1(18),3(8),4,6,13,16-hexaen-9-one |
| Manual Xrefs | Databases |
|---|---|
| 78436379 | ChemSpider |