EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O7S2 |
| Net Charge | 0 |
| Average Mass | 438.483 |
| Monoisotopic Mass | 438.05554 |
| SMILES | O=C1C=C[C@H](O)[C@@H]2[C@@H]1CC13SSC4(C[C@H]5C(=O)C[C@H](O)[C@H](O)[C@H]5N4C1=O)C(=O)N23 |
| InChI | InChI=1S/C18H18N2O7S2/c21-8-1-2-9(22)12-6(8)4-17-16(27)20-13-7(10(23)3-11(24)14(13)25)5-18(20,29-28-17)15(26)19(12)17/h1-2,6-7,9,11-14,22,24-25H,3-5H2/t6-,7+,9+,11+,12+,13+,14+,17?,18?/m1/s1 |
| InChIKey | NCDIBOQDVNONGL-AONPJNASSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stereum hirsutum (ncbitaxon:40492) | - | PubMed (11513044) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epicorazine C (CHEBI:198575) is a 2,5-diketopiperazines (CHEBI:65061) |
| Epicorazine C (CHEBI:198575) is a indoles (CHEBI:24828) |
| Epicorazine C (CHEBI:198575) is a organic disulfide (CHEBI:35489) |
| Epicorazine C (CHEBI:198575) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (4S,5S,9S,14S,15R,16S,19R)-5,15,16-trihydroxy-21,22-dithia-3,13-diazahexacyclo[9.9.2.01,13.03,11.04,9.014,19]docos-6-ene-2,8,12,18-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 78442458 | ChemSpider |