EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O5 |
| Net Charge | 0 |
| Average Mass | 352.386 |
| Monoisotopic Mass | 352.13107 |
| SMILES | Cc1c(C(=O)CCC(C)C)cc2c(c1O)C(=O)C(=O)c1c(O)cccc1-2 |
| InChI | InChI=1S/C21H20O5/c1-10(2)7-8-15(22)13-9-14-12-5-4-6-16(23)17(12)20(25)21(26)18(14)19(24)11(13)3/h4-6,9-10,23-24H,7-8H2,1-3H3 |
| InChIKey | UJTRABFYSZAGLW-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces pilosus (ncbitaxon:28893) | - | PubMed (14076692) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Piloquinone (CHEBI:198573) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| 1,8-dihydroxy-2-methyl-3-(4-methylpentanoyl)phenanthrene-9,10-dione |
| Manual Xrefs | Databases |
|---|---|
| 542652 | ChemSpider |