EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4 |
| Net Charge | 0 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04226 |
| SMILES | C/C(=C/C(=O)O)CC(=O)O |
| InChI | InChI=1S/C6H8O4/c1-4(2-5(7)8)3-6(9)10/h2H,3H2,1H3,(H,7,8)(H,9,10)/b4-2- |
| InChIKey | WKRBKYFIJPGYQC-RQOWECAXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Akanthomyces muscarius (ncbitaxon:2231603) | - | DOI (10.1016/0031-9422(94)00723-7) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Z-3-Methylpent-2-en-1,5-dioic acid (CHEBI:198535) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| (Z)-3-methylpent-2-enedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 796421 | ChemSpider |