EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19ClO7 |
| Net Charge | 0 |
| Average Mass | 382.796 |
| Monoisotopic Mass | 382.08193 |
| SMILES | C[C@@H]1CC(O)C2C=CC(CC(=O)Cc3c(Cl)c(O)cc(O)c3C(=O)O1)O2 |
| InChI | InChI=1S/C18H19ClO7/c1-8-4-12(21)15-3-2-10(26-15)5-9(20)6-11-16(18(24)25-8)13(22)7-14(23)17(11)19/h2-3,7-8,10,12,15,21-23H,4-6H2,1H3/t8-,10?,12?,15?/m1/s1 |
| InChIKey | QQPHIAUHVZLJOT-ZPHDGDPNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humicola (ncbitaxon:5526) | - | PubMed (24495105) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Radicicol D (CHEBI:198530) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (13R)-6-chloro-7,9,15-trihydroxy-13-methyl-12,19-dioxatricyclo[14.2.1.05,10]nonadeca-5(10),6,8,17-tetraene-3,11-dione |
| Manual Xrefs | Databases |
|---|---|
| 24620234 | ChemSpider |