EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O7 |
| Net Charge | 0 |
| Average Mass | 342.348 |
| Monoisotopic Mass | 342.14270 |
| SMILES | N[C@H](CO)[C@H](O)[C@H](O)[C@@H](O)C(=O)N[C@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H22N2O7/c16-9(7-18)12(21)13(22)14(23)15(24)17-10(6-11(19)20)8-4-2-1-3-5-8/h1-5,9-10,12-14,18,21-23H,6-7,16H2,(H,17,24)(H,19,20)/t9-,10-,12+,13+,14-/m1/s1 |
| InChIKey | GVOBXKQKXYPNTR-SJVBDLOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bacillusspecies (in: firmicutes) (ncbitaxon:1409) | - | PubMed (11827035) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyloricidin D (CHEBI:198528) is a benzenes (CHEBI:22712) |
| Pyloricidin D (CHEBI:198528) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (3R)-3-[[(2R,3S,4S,5R)-5-amino-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78436368 | ChemSpider |