EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H43N3O7 |
| Net Charge | 0 |
| Average Mass | 617.743 |
| Monoisotopic Mass | 617.31010 |
| SMILES | CCCCCC(=O)N[C@H](CCc1ccc(O)cc1)C(=O)N[C@@H](CCc1ccc(O)cc1)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C35H43N3O7/c1-2-3-5-10-32(41)36-29(21-15-24-11-17-27(39)18-12-24)33(42)37-30(22-16-25-13-19-28(40)20-14-25)34(43)38-31(35(44)45)23-26-8-6-4-7-9-26/h4,6-9,11-14,17-20,29-31,39-40H,2-3,5,10,15-16,21-23H2,1H3,(H,36,41)(H,37,42)(H,38,43)(H,44,45)/t29-,30+,31-/m1/s1 |
| InChIKey | XFLVJFHNXBWJDL-MJSOWUPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dolichospermumspeciesroides (ncbitaxon:135104) | - | PubMed (12088439) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spiroidesin (CHEBI:198456) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2R)-2-[[(2S)-2-[[(2R)-2-(hexanoylamino)-4-(4-hydroxyphenyl)butanoyl]amino]-4-(4-hydroxyphenyl)butanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 553432 | ChemSpider |