EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30O6 |
| Net Charge | 0 |
| Average Mass | 390.476 |
| Monoisotopic Mass | 390.20424 |
| SMILES | CCCCC/C=C/C1=C2COC(C)(C)O[C@H]2[C@H]2O[C@@]2(C/C=C(\C)C(=O)O)C1=O |
| InChI | InChI=1S/C22H30O6/c1-5-6-7-8-9-10-15-16-13-26-21(3,4)27-17(16)19-22(28-19,18(15)23)12-11-14(2)20(24)25/h9-11,17,19H,5-8,12-13H2,1-4H3,(H,24,25)/b10-9+,14-11+/t17-,19-,22+/m1/s1 |
| InChIKey | KJESBKJFNPXHOA-LNZGVCCXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Multiclavulaspecies (ncbitaxon:2506259) | - | PubMed (19117486) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-[(1aR,7aR,7bR)-3-[(E)-hept-1-enyl]-6,6-dimethyl-2-oxo-7a,7b-dihydro-4H-oxireno[2,3-h][1,3]benzodioxin-1a-yl]-2-methylbut-2-enoic acid (CHEBI:198455) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| (E)-4-[(1aR,7aR,7bR)-3-[(E)-hept-1-enyl]-6,6-dimethyl-2-oxo-7a,7b-dihydro-4H-oxireno[2,3-h][1,3]benzodioxin-1a-yl]-2-methylbut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 24625665 | ChemSpider |