EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N3O9 |
| Net Charge | 0 |
| Average Mass | 413.383 |
| Monoisotopic Mass | 413.14343 |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)NC(C(=O)O)[C@H]1[C@H](O)[C@]2(O)CO[C@@H]([C@@H]2O)N1O |
| InChI | InChI=1S/C17H23N3O9/c18-9(5-7-1-3-8(21)4-2-7)14(24)19-10(16(25)26)11-12(22)17(27)6-29-15(13(17)23)20(11)28/h1-4,9-13,15,21-23,27-28H,5-6,18H2,(H,19,24)(H,25,26)/t9-,10?,11-,12-,13-,15-,17+/m0/s1 |
| InChIKey | JOBDOAKLPNMGKV-DSPXQUDOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora (ncbitaxon:1873) | - | PubMed (10866216) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SB-219383 (CHEBI:198432) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-2-[(1S,3S,4S,5R,8R)-2,4,5,8-tetrahydroxy-7-oxa-2-azabicyclo[3.2.1]octan-3-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 8891994 | ChemSpider |