EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9ClO5 |
| Net Charge | 0 |
| Average Mass | 244.630 |
| Monoisotopic Mass | 244.01385 |
| SMILES | C[C@H]1OC(=O)c2c(O)cc(O)c(Cl)c2[C@H]1O |
| InChI | InChI=1S/C10H9ClO5/c1-3-9(14)7-6(10(15)16-3)4(12)2-5(13)8(7)11/h2-3,9,12-14H,1H3/t3-,9+/m1/s1 |
| InChIKey | ADCGGGYNNDZRRJ-OLLQQOEVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-chloro-4,6-dihydroxymellein (CHEBI:198410) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R,4R)-5-chloro-4,6,8-trihydroxy-3-methyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 78436356 | ChemSpider |