EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38N2O9 |
| Net Charge | 0 |
| Average Mass | 534.606 |
| Monoisotopic Mass | 534.25773 |
| SMILES | CCCCCC1C(=O)OC(C)C(NC(=O)c2cccc(NC=O)c2O)C(=O)OC(C)C1OC(=O)C(C)CC |
| InChI | InChI=1S/C27H38N2O9/c1-6-8-9-11-19-23(38-25(33)15(3)7-2)17(5)37-27(35)21(16(4)36-26(19)34)29-24(32)18-12-10-13-20(22(18)31)28-14-30/h10,12-17,19,21,23,31H,6-9,11H2,1-5H3,(H,28,30)(H,29,32) |
| InChIKey | CRIAYTZRPXXKCY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies GAAS7310 (ncbitaxon:632139) | - | PubMed (16266124) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Antimycin A17 (CHEBI:198351) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| [3-[(3-ormamido-2-hydroxybenzoyl)amino]-2,6-dimethyl-4,9-dioxo-8-pentyl-1,5-dioxonan-7-yl] 2-methylbutanoate |
| Manual Xrefs | Databases |
|---|---|
| 9795512 | ChemSpider |