EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H51ClN4O6 |
| Net Charge | 0 |
| Average Mass | 575.191 |
| Monoisotopic Mass | 574.34971 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](O)[C@H](N)CCCCCCCCl)C(=O)N(C)[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C28H51ClN4O6/c1-6-19(4)23(31-25(35)24(34)20(30)13-10-8-7-9-11-15-29)27(37)32(5)22(17-18(2)3)26(36)33-16-12-14-21(33)28(38)39/h18-24,34H,6-17,30H2,1-5H3,(H,31,35)(H,38,39)/t19-,20+,21-,22-,23-,24+/m0/s1 |
| InChIKey | MECPYWUIDGLDCB-DVZKKUMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyanobacterium (ncbitaxon:102234) | - | DOI (10.1016/s0040-4020(00)00770-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Microginin 91-A (CHEBI:198278) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-2-[[(2S,3S)-2-[[(2R,3R)-3-amino-10-chloro-2-hydroxydecanoyl]amino]-3-methylpentanoyl]-methylamino]-4-methylpentanoyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 8992271 | ChemSpider |