EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H85N7O13 |
| Net Charge | 0 |
| Average Mass | 968.244 |
| Monoisotopic Mass | 967.62054 |
| SMILES | CCC(C)C1C(=O)N(C)C(C(C)C)C(=O)N(C)C(CC(C)C)C(=O)NC(CO)C(=O)OC(C(C)C)C(=O)N(C)C(C)C(=O)OC(C(C)C)C(=O)N(C)C(C(C)O)C(=O)NC(CC(C)C)C(=O)N1C |
| InChI | InChI=1S/C48H85N7O13/c1-20-29(12)36-44(62)53(17)35(26(6)7)43(61)52(16)34(22-25(4)5)40(58)50-33(23-56)48(66)68-38(27(8)9)45(63)51(15)30(13)47(65)67-39(28(10)11)46(64)55(19)37(31(14)57)41(59)49-32(21-24(2)3)42(60)54(36)18/h24-39,56-57H,20-23H2,1-19H3,(H,49,59)(H,50,58) |
| InChIKey | NZTGVGORBGCOFL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bipolaris zeicola (ncbitaxon:5017) | - | DOI (10.1016/0040-4039(94)88218-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BZR-cotoxin I (CHEBI:198246) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 18-butan-2-yl-24-(1-hydroxyethyl)-9-(hydroxymethyl)-3,4,13,16,19,25-hexamethyl-12,21-bis(2-methylpropyl)-6,15,27-tri(propan-2-yl)-1,7-dioxa-4,10,13,16,19,22,25-heptazacycloheptacosane-2,5,8,11,14,17,20,23,26-nonone |
| Manual Xrefs | Databases |
|---|---|
| 155428 | ChemSpider |