EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H50O5 |
| Net Charge | 0 |
| Average Mass | 526.758 |
| Monoisotopic Mass | 526.36582 |
| SMILES | CC(=O)O[C@@H]1CC[C@]2(C)C3=C(CC[C@H]2C1(C)C)[C@]1(C)CC[C@@H]2[C@H](C)C[C@@]4(OC(=O)[C@@H](C)[C@@H]4C)O[C@H](C3)[C@]21C |
| InChI | InChI=1S/C33H50O5/c1-18-17-33(20(3)19(2)28(35)38-33)37-27-16-24-23(31(8)15-12-22(18)32(27,31)9)10-11-25-29(5,6)26(36-21(4)34)13-14-30(24,25)7/h18-20,22,25-27H,10-17H2,1-9H3/t18-,19+,20+,22-,25+,26-,27-,30-,31+,32+,33+/m1/s1 |
| InChIKey | SGSMRLJTYJLFMA-FPOLEOGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodofomes cajanderi (ncbitaxon:2066993) | - | PubMed (14510609) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fomlactone A (CHEBI:198238) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| [(1S,3'S,4'S,5R,7R,10S,13R,15S,17R,18R,21R)-1,3',4',6,6,10,17,21-octamethyl-5'-oxospiro[14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicos-2(11)-ene-15,2'-oxolane]-7-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 9246622 | ChemSpider |