EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O4 |
| Net Charge | 0 |
| Average Mass | 262.265 |
| Monoisotopic Mass | 262.09536 |
| SMILES | CN1C(=O)[C@]2(O)Cc3ccccc3N2C(=O)[C@@H]1CO |
| InChI | InChI=1S/C13H14N2O4/c1-14-10(7-16)11(17)15-9-5-3-2-4-8(9)6-13(15,19)12(14)18/h2-5,10,16,19H,6-7H2,1H3/t10-,13+/m0/s1 |
| InChIKey | FHJQHCKBAXMQOE-GXFFZTMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dichotomomyces (ncbitaxon:255780) | - | PubMed (27618072) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dichotocejpin C (CHEBI:198179) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (3S,10aR)-10a-hydroxy-3-(hydroxymethyl)-2-methyl-3,10-dihydropyrazino[1,2-a]indole-1,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 78440712 | ChemSpider |