EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O6 |
| Net Charge | 0 |
| Average Mass | 310.306 |
| Monoisotopic Mass | 310.11649 |
| SMILES | CCOC(=O)[C@@H](NC(=O)c1cccc(NC=O)c1O)[C@@H](C)O |
| InChI | InChI=1S/C14H18N2O6/c1-3-22-14(21)11(8(2)18)16-13(20)9-5-4-6-10(12(9)19)15-7-17/h4-8,11,18-19H,3H2,1-2H3,(H,15,17)(H,16,20)/t8-,11+/m1/s1 |
| InChIKey | RXPVGQMHHCYAKH-KCJUWKMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (27379435) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptomyceamide C (CHEBI:198178) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| ethyl (2S,3R)-2-[(3-ormamido-2-hydroxybenzoyl)amino]-3-hydroxybutanoate |
| Manual Xrefs | Databases |
|---|---|
| 58197220 | ChemSpider |