EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H49N7O10 |
| Net Charge | 0 |
| Average Mass | 679.772 |
| Monoisotopic Mass | 679.35409 |
| SMILES | CCCCCC(CC(=O)N1N=CCCC1C(=O)N[C@H]1COC(=O)[C@H]2C[C@@H](O)CNN2C(=O)[C@H](C)NC(=O)[C@@H](CC(C)C)NC1=O)C(=O)O |
| InChI | InChI=1S/C31H49N7O10/c1-5-6-7-9-19(30(45)46)13-25(40)37-23(10-8-11-32-37)28(43)36-22-16-48-31(47)24-14-20(39)15-33-38(24)29(44)18(4)34-26(41)21(12-17(2)3)35-27(22)42/h11,17-24,33,39H,5-10,12-16H2,1-4H3,(H,34,41)(H,35,42)(H,36,43)(H,45,46)/t18-,19?,20+,21+,22-,23?,24+/m0/s1 |
| InChIKey | KHOLPVDDEDKHJE-YKGAZLOOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (16619323) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lydiamycin B (CHEBI:198175) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 2-[2-[3-[[(3S,6R,9S,13R,15R)-15-hydroxy-3-methyl-6-(2-methylpropyl)-2,5,8,12-tetraoxo-11-oxa-1,4,7,17-tetrazabicyclo[11.4.0]heptadecan-9-yl]carbamoyl]-4,5-dihydro-3H-pyridazin-2-yl]-2-oxoethyl]heptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9889243 | ChemSpider |