EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32N4O4 |
| Net Charge | 0 |
| Average Mass | 488.588 |
| Monoisotopic Mass | 488.24236 |
| SMILES | O=C1N[C@@H](Cc2ccccc2)C(=O)N2CCC[C@H]2C(=O)N[C@@H](Cc2ccccc2)C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C28H32N4O4/c33-25-23-13-8-16-32(23)28(36)22(18-20-11-5-2-6-12-20)30-26(34)24-14-7-15-31(24)27(35)21(29-25)17-19-9-3-1-4-10-19/h1-6,9-12,21-24H,7-8,13-18H2,(H,29,33)(H,30,34)/t21-,22-,23-,24-/m0/s1 |
| InChIKey | QLPBAXRSKZBNQY-ZJZGAYNASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonasspecies (ncbitaxon:306) | - | DOI (10.1016/j.tet.2008.01.089) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclo(Pro-Phe-Pro-Phe) (CHEBI:198173) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3S,6S,12S,15S)-3,12-dibenzyl-1,4,10,13-tetrazatricyclo[13.3.0.06,10]octadecane-2,5,11,14-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 78439577 | ChemSpider |