EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H17ClO7 |
| Net Charge | 0 |
| Average Mass | 368.769 |
| Monoisotopic Mass | 368.06628 |
| SMILES | COC(=O)c1c(O)cc(OC)c(Cl)c1Oc1c(C)cc(O)cc1OC |
| InChI | InChI=1S/C17H17ClO7/c1-8-5-9(19)6-12(23-3)15(8)25-16-13(17(21)24-4)10(20)7-11(22-2)14(16)18/h5-7,19-20H,1-4H3 |
| InChIKey | FAWUCQOMRPWLBP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (23216132) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-chloro-7,4'-dihydroxy-5,2'-dimethoxy-2-methylformate-6'-methybenzophone (CHEBI:198145) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| methyl 3-chloro-6-hydroxy-2-(4-hydroxy-2-methoxy-6-methylphenoxy)-4-methoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 27025746 | ChemSpider |