EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H44N6O5 |
| Net Charge | 0 |
| Average Mass | 616.763 |
| Monoisotopic Mass | 616.33732 |
| SMILES | N=C(N)N1CC=C(CCNC(=O)[C@@H]2CC3CCC(O)CC3N2C(=O)C(Cc2ccccc2)NC(=O)[C@H](O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C34H44N6O5/c35-34(36)39-16-14-24(21-39)13-15-37-31(43)29-19-25-11-12-26(41)20-28(25)40(29)33(45)27(17-22-7-3-1-4-8-22)38-32(44)30(42)18-23-9-5-2-6-10-23/h1-10,14,25-30,41-42H,11-13,15-21H2,(H3,35,36)(H,37,43)(H,38,44)/t25?,26?,27?,28?,29-,30+/m0/s1 |
| InChIKey | YNAKQOCSOOKXJP-IFNBDZAXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Planktothrix agardhii (ncbitaxon:1160) | - | PubMed (15137772) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oscillarin (CHEBI:198135) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-N-[2-(1-carbamimidoyl-2,5-dihydropyrrol-3-yl)ethyl]-6-hydroxy-1-[2-[[(2R)-2-hydroxy-3-phenylpropanoyl]amino]-3-phenylpropanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 10480056 | ChemSpider |