EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H47ClN4O8 |
| Net Charge | 0 |
| Average Mass | 615.168 |
| Monoisotopic Mass | 614.30824 |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CCc1ccc(O)cc1)C(=O)O)N(C)C(=O)[C@H](CO)NC(=O)[C@@H](O)[C@H](N)CCCCCCCCl |
| InChI | InChI=1S/C29H47ClN4O8/c1-18(2)24(26(38)32-22(29(41)42)15-12-19-10-13-20(36)14-11-19)34(3)28(40)23(17-35)33-27(39)25(37)21(31)9-7-5-4-6-8-16-30/h10-11,13-14,18,21-25,35-37H,4-9,12,15-17,31H2,1-3H3,(H,32,38)(H,33,39)(H,41,42)/t21-,22+,23+,24+,25+/m1/s1 |
| InChIKey | QYOGCHNVZHLFTR-RYWAYVEBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Planktothrix agardhii (ncbitaxon:1160) | - | DOI (10.1016/s0031-9422(96)00767-4) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oscillaginin A (CHEBI:198099) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S,3R)-3-amino-10-chloro-2-hydroxydecanoyl]amino]-3-hydroxypropanoyl]-methylamino]-3-methylbutanoyl]amino]-4-(4-hydroxyphenyl)butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 34233455 | ChemSpider |