EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O5 |
| Net Charge | 0 |
| Average Mass | 282.336 |
| Monoisotopic Mass | 282.14672 |
| SMILES | CC1=C(C(=O)O)[C@@]2(C)CCC[C@](C)(C(=O)O)[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C15H22O5/c1-8-9(16)7-10-14(2,11(8)12(17)18)5-4-6-15(10,3)13(19)20/h9-10,16H,4-7H2,1-3H3,(H,17,18)(H,19,20)/t9-,10+,14-,15-/m0/s1 |
| InChIKey | CEIDCYCXCMFPMO-OWLDWWDNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arecophila (ncbitaxon:189360) | - | PubMed (23079766) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arecoic acid E (CHEBI:198092) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (1S,4aS,7S,8aR)-7-hydroxy-1,4a,6-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-1,5-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442266 | ChemSpider |