EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24ClNO4 |
| Net Charge | 0 |
| Average Mass | 341.835 |
| Monoisotopic Mass | 341.13939 |
| SMILES | CCC(=O)[C@H](Cc1ccc(O)c(Cl)c1)NC(=O)[C@@H](O)[C@@H](C)CC |
| InChI | InChI=1S/C17H24ClNO4/c1-4-10(3)16(22)17(23)19-13(14(20)5-2)9-11-6-7-15(21)12(18)8-11/h6-8,10,13,16,21-22H,4-5,9H2,1-3H3,(H,19,23)/t10-,13-,16-/m0/s1 |
| InChIKey | GQUNWFSEBZMTLB-NKFCBESUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Herpetosiphon aurantiacus (ncbitaxon:65) | - | DOI (10.1002/ejoc.201500181) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Auriculamide (CHEBI:198077) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (2S,3S)-N-[(2S)-1-(3-chloro-4-hydroxyphenyl)-3-oxopentan-2-yl]-2-hydroxy-3-methylpentanamide |
| Manual Xrefs | Databases |
|---|---|
| 35000209 | ChemSpider |