EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N4O6 |
| Net Charge | 0 |
| Average Mass | 494.548 |
| Monoisotopic Mass | 494.21653 |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1cc2c(nc3ccccc32)c(CCC(=O)N2CCC[C@H]2C(=O)O)n1)C(=O)O |
| InChI | InChI=1S/C26H30N4O6/c1-3-14(2)22(26(35)36)29-24(32)19-13-16-15-7-4-5-8-17(15)28-23(16)18(27-19)10-11-21(31)30-12-6-9-20(30)25(33)34/h4-5,7-8,13-14,20,22,28H,3,6,9-12H2,1-2H3,(H,29,32)(H,33,34)(H,35,36)/t14-,20-,22-/m0/s1 |
| InChIKey | GYEWKSZSKYZTOR-FSJXIACGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycena metata (ncbitaxon:1033252) | - | PubMed (23330951) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metatacarboline G (CHEBI:198071) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| (2S)-1-[3-[3-[[(1S,2S)-1-carboxy-2-methylbutyl]carbamoyl]-9H-pyrido[3,4-b]indol-1-yl]propanoyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78436315 | ChemSpider |