EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H59N5O9 |
| Net Charge | 0 |
| Average Mass | 741.927 |
| Monoisotopic Mass | 741.43128 |
| SMILES | CCCC1OC(=O)CNC(=O)[C@@H](Cc2ccccc2)N(C)C(=O)[C@@H]2CCCN2C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](C)NC(=O)[C@H](C(C)C)OC(=O)C1(C)C |
| InChI | InChI=1S/C39H59N5O9/c1-11-16-29-39(7,8)38(51)53-32(24(4)5)34(47)41-25(6)35(48)43(10)31(23(2)3)37(50)44-20-15-19-27(44)36(49)42(9)28(21-26-17-13-12-14-18-26)33(46)40-22-30(45)52-29/h12-14,17-18,23-25,27-29,31-32H,11,15-16,19-22H2,1-10H3,(H,40,46)(H,41,47)/t25-,27-,28+,29?,31-,32-/m0/s1 |
| InChIKey | WIFAOXKADBNEPT-SVBROBQKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya majuscula (ncbitaxon:158786) | - | PubMed (12828459) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guineamide E (CHEBI:198065) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6S,9S,19R,22S)-19-benzyl-4,6,12,12,20-pentamethyl-3,9-di(propan-2-yl)-13-propyl-10,14-dioxa-1,4,7,17,20-pentazabicyclo[20.3.0]pentacosane-2,5,8,11,15,18,21-heptone |
| Manual Xrefs | Databases |
|---|---|
| 9051650 | ChemSpider |