EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30N2O |
| Net Charge | 0 |
| Average Mass | 386.539 |
| Monoisotopic Mass | 386.23581 |
| SMILES | [C-]#[N+][C@]12C(=C)C(C)(C)c3nc4cccc5c4c3[C@]1(O)[C@H](CC[C@]2(C)C=C)C5(C)C |
| InChI | InChI=1S/C26H30N2O/c1-9-24(7)14-13-18-23(5,6)16-11-10-12-17-19(16)20-21(28-17)22(3,4)15(2)26(24,27-8)25(18,20)29/h9-12,18,28-29H,1-2,13-14H2,3-7H3/t18-,24+,25-,26+/m1/s1 |
| InChIKey | VARACNJZOYFAJE-JBSJPJJHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fischerella ambigua UTEX 1903 (ncbitaxon:230521) | - | PubMed (20965528) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fischambiguine A (CHEBI:198060) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (10R,11R,14R,15R)-11-ethenyl-10-isocyano-8,8,11,18,18-pentamethyl-9-methylidene-6-azapentacyclo[12.3.1.05,17.07,16.010,15]octadeca-1(17),2,4,7(16)-tetraen-15-ol |
| Manual Xrefs | Databases |
|---|---|
| 28288193 | ChemSpider |