EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28O10 |
| Net Charge | 0 |
| Average Mass | 548.544 |
| Monoisotopic Mass | 548.16825 |
| SMILES | COc1c2c3c4c5c(c(=O)cc(OC)c5c5c(OC)cc(=O)c(c1O)c35)=C(O)[C@@H](OC)[C@]4(CC(C)O)[C@@H]2C(C)=O |
| InChI | InChI=1S/C30H28O10/c1-10(31)9-30-24(11(2)32)23-22-20-16(26(35)28(23)39-5)12(33)7-14(37-3)18(20)19-15(38-4)8-13(34)17(21(19)25(22)30)27(36)29(30)40-6/h7-8,10,24,29,31,35-36H,9H2,1-6H3/t10?,24-,29-,30-/m1/s1 |
| InChIKey | QKTMSQABFALFDG-HTKIONCRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phaeosphaeriaspecies (ncbitaxon:1715242) | - | PubMed (22276650) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phaeosphaerin C (CHEBI:198036) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| (12S,13R,14S)-12-acetyl-9,15-dihydroxy-13-(2-hydroxypropyl)-5,10,14,19-tetramethoxyhexacyclo[11.8.0.02,11.03,8.04,20.016,21]henicosa-1(21),2(11),3(8),4(20),5,9,15,18-octaene-7,17-dione |
| Manual Xrefs | Databases |
|---|---|
| 78436309 | ChemSpider |