EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H57N5O9 |
| Net Charge | 0 |
| Average Mass | 787.955 |
| Monoisotopic Mass | 787.41563 |
| SMILES | CC(NC(=O)CC(O)C(Cc1ccccc1)NC(=O)C(NC(=O)C(NC(=O)Cc1ccccc1)C(C)C)C(C)C)C(=O)NC(Cc1ccccc1)C(O)CC(=O)O |
| InChI | InChI=1S/C43H57N5O9/c1-26(2)39(47-36(51)23-31-19-13-8-14-20-31)43(57)48-40(27(3)4)42(56)46-32(21-29-15-9-6-10-16-29)34(49)24-37(52)44-28(5)41(55)45-33(35(50)25-38(53)54)22-30-17-11-7-12-18-30/h6-20,26-28,32-35,39-40,49-50H,21-25H2,1-5H3,(H,44,52)(H,45,55)(H,46,56)(H,47,51)(H,48,57)(H,53,54) |
| InChIKey | AQRATHKYNQIHRE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8040057) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YF-044-P-D (CHEBI:198030) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 3-hydroxy-4-[2-[[3-hydroxy-4-[[3-methyl-2-[[3-methyl-2-[(2-phenylacetyl)amino]butanoyl]amino]butanoyl]amino]-5-phenylpentanoyl]amino]propanoylamino]-5-phenylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 165805 | ChemSpider |