EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H61N5O9 |
| Net Charge | 0 |
| Average Mass | 731.932 |
| Monoisotopic Mass | 731.44693 |
| SMILES | CCCCCCC[C@@H]1CC(=O)N[C@H](CC(C)C)C(=O)N[C@H](CO)C(=O)N[C@H]([C@H](C)O)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](C(C)CC)C(=O)O1 |
| InChI | InChI=1S/C38H61N5O9/c1-7-9-10-11-15-18-27-21-31(46)39-28(19-23(3)4)34(47)41-30(22-44)36(49)43-33(25(6)45)37(50)40-29(20-26-16-13-12-14-17-26)35(48)42-32(24(5)8-2)38(51)52-27/h12-14,16-17,23-25,27-30,32-33,44-45H,7-11,15,18-22H2,1-6H3,(H,39,46)(H,40,50)(H,41,47)(H,42,48)(H,43,49)/t24?,25-,27+,28+,29-,30+,32-,33+/m0/s1 |
| InChIKey | JJJUZZODDZXKCZ-YRMLTHTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eubacteriumspecies (ncbitaxon:142586) | - | DOI (10.1016/s0040-4020(98)00187-2) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Serratiomycin (CHEBI:197999) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6S,9R,12R,15R,19R)-6-benzyl-3-butan-2-yl-19-heptyl-9-[(1S)-1-hydroxyethyl]-12-(hydroxymethyl)-15-(2-methylpropyl)-1-oxa-4,7,10,13,16-pentazacyclononadecane-2,5,8,11,14,17-hexone |
| Manual Xrefs | Databases |
|---|---|
| 78436303 | ChemSpider |