EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H55N5O7S |
| Net Charge | 0 |
| Average Mass | 701.931 |
| Monoisotopic Mass | 701.38222 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H]1CCCCN1C)C(=O)N(CO)[C@H](CCc1nc(C(=O)N[C@@H](Cc2ccc(O)cc2)C[C@H](C)C(=O)O)cs1)C(C)C |
| InChI | InChI=1S/C36H55N5O7S/c1-7-23(4)32(39-34(45)30-10-8-9-17-40(30)6)35(46)41(21-42)29(22(2)3)15-16-31-38-28(20-49-31)33(44)37-26(18-24(5)36(47)48)19-25-11-13-27(43)14-12-25/h11-14,20,22-24,26,29-30,32,42-43H,7-10,15-19,21H2,1-6H3,(H,37,44)(H,39,45)(H,47,48)/t23-,24-,26+,29+,30+,32-/m0/s1 |
| InChIKey | XAFVAXJSLRHROK-HQURSRCASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cystobacterspecies SBCb004 (ncbitaxon:764904) | - | PubMed (20338521) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxymethyl pretubulysin (CHEBI:197978) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,4R)-4-[[2-[(3R)-3-[hydroxymethyl-[(2S,3S)-3-methyl-2-[[(2R)-1-methylpiperidine-2-carbonyl]amino]pentanoyl]amino]-4-methylpentyl]-1,3-thiazole-4-carbonyl]amino]-5-(4-hydroxyphenyl)-2-methylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442448 | ChemSpider |