EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:197975 - 2,3-dihydroxy-N-benzoylserine dimer
| Formula | C20H20N2O11 |
| Net Charge | 0 |
| Average Mass | 464.383 |
| Monoisotopic Mass | 464.10671 |
| SMILES | O=C(N[C@@H](COC(=O)[C@H](CO)NC(=O)c1cccc(O)c1O)C(=O)O)c1cccc(O)c1O |
| InChI | InChI=1S/C20H20N2O11/c23-7-11(21-17(28)9-3-1-5-13(24)15(9)26)20(32)33-8-12(19(30)31)22-18(29)10-4-2-6-14(25)16(10)27/h1-6,11-12,23-27H,7-8H2,(H,21,28)(H,22,29)(H,30,31)/t11-,12-/m0/s1 |
| InChIKey | KLXJDVFEFZPIMN-RYUDHWBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (11267771) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dihydroxy-N-benzoylserine dimer (CHEBI:197975) has functional parent N-benzoylglycine (CHEBI:18089) |
| 2,3-dihydroxy-N-benzoylserine dimer (CHEBI:197975) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| (2S)-2-[(2,3-dihydroxybenzoyl)amino]-3-[(2S)-2-[(2,3-dihydroxybenzoyl)amino]-3-hydroxypropanoyl]oxypropanoic acid |