EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO6 |
| Net Charge | 0 |
| Average Mass | 373.405 |
| Monoisotopic Mass | 373.15254 |
| SMILES | CC(C)CC(=O)NC(=O)c1coc(/C=C/CC/C=C/C=C/C(=O)O)cc1=O |
| InChI | InChI=1S/C20H23NO6/c1-14(2)11-18(23)21-20(26)16-13-27-15(12-17(16)22)9-7-5-3-4-6-8-10-19(24)25/h4,6-10,12-14H,3,5,11H2,1-2H3,(H,24,25)(H,21,23,26)/b6-4+,9-7+,10-8+ |
| InChIKey | XMYHWVMJOYWQFI-FCGWLDPVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Poronia (ncbitaxon:101474) | - | DOI (10.1016/j.tetlet.2012.06.128) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Poronitin A (CHEBI:197965) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E,8E)-9-[5-(3-methylbutanoylcarbamoyl)-4-oxopyran-2-yl]nona-2,4,8-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434606 | ChemSpider |