EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N2O10 |
| Net Charge | 0 |
| Average Mass | 562.616 |
| Monoisotopic Mass | 562.25265 |
| SMILES | CCC(C)C1OC(=O)[C@@H](NC(=O)c2cccc(NC=O)c2O)[C@H](C)OC(=O)C(C)(C)C(=O)C(CC(C)C)OC1=O |
| InChI | InChI=1S/C28H38N2O10/c1-8-15(4)22-26(36)39-19(12-14(2)3)23(33)28(6,7)27(37)38-16(5)20(25(35)40-22)30-24(34)17-10-9-11-18(21(17)32)29-13-31/h9-11,13-16,19-20,22,32H,8,12H2,1-7H3,(H,29,31)(H,30,34)/t15?,16-,19?,20-,22?/m0/s1 |
| InChIKey | DGUFUEHCXSEKMT-GBCVEWGJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (18503204) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[(6S,7S)-3-Butan-2-yl-7,10,10-trimethyl-12-(2-methylpropyl)-2,5,9,11-tetraoxo-1,4,8-trioxacyclododec-6-yl]-3-formamido-2-hydroxybenzamide (CHEBI:197960) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| N-[(6S,7S)-3-butan-2-yl-7,10,10-trimethyl-12-(2-methylpropyl)-2,5,9,11-tetraoxo-1,4,8-trioxacyclododec-6-yl]-3-ormamido-2-hydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 28285294 | ChemSpider |