EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17NO4 |
| Net Charge | 0 |
| Average Mass | 215.249 |
| Monoisotopic Mass | 215.11576 |
| SMILES | CC(C)C[C@]1(C(=O)O)C[C@@](C)(C(=O)O)N1 |
| InChI | InChI=1S/C10H17NO4/c1-6(2)4-10(8(14)15)5-9(3,11-10)7(12)13/h6,11H,4-5H2,1-3H3,(H,12,13)(H,14,15)/t9-,10+/m0/s1 |
| InChIKey | DTLNBWQUOUXKIO-VHSXEESVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monascus pilosus (ncbitaxon:89488) | - | PubMed (15043438) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (-)-monascumic acid (CHEBI:197954) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S,4R)-2-methyl-4-(2-methylpropyl)azetidine-2,4-dicarboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 9427916 | ChemSpider |