EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O6 |
| Net Charge | 0 |
| Average Mass | 224.168 |
| Monoisotopic Mass | 224.03209 |
| SMILES | O=C(O)C[C@@H]1OC(=O)c2c(O)cc(O)cc21 |
| InChI | InChI=1S/C10H8O6/c11-4-1-5-7(3-8(13)14)16-10(15)9(5)6(12)2-4/h1-2,7,11-12H,3H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | YIQRZXRYUUYARN-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium herbarum (ncbitaxon:29918) | - | DOI (10.1021/np010390i) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Herbaric acid (CHEBI:197953) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-(4,6-dihydroxy-3-oxo-1H-2-benzouran-1-yl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 9250183 | ChemSpider |