EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H72N6O8 |
| Net Charge | 0 |
| Average Mass | 801.083 |
| Monoisotopic Mass | 800.54116 |
| SMILES | CC[C@H](C)[C@@H](C(=O)N(C)[C@H](C(=O)O)C(C)C)N(C)C(=O)[C@@H](NC(=O)[C@H](C(C)C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)[C@H](C(C)C)N(C)C(=O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C43H72N6O8/c1-18-29(12)36(42(55)48(16)35(28(10)11)43(56)57)49(17)39(52)31(24(2)3)44-37(50)32(25(4)5)45(13)40(53)34(27(8)9)47(15)41(54)33(26(6)7)46(14)38(51)30-22-20-19-21-23-30/h19-29,31-36H,18H2,1-17H3,(H,44,50)(H,56,57)/t29-,31-,32-,33-,34-,35-,36-/m0/s1 |
| InChIKey | OJXSCBQWQXUTTR-ZBZKAUHLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pterulaspecies (ncbitaxon:2040936) | - | PubMed (17067148) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pterulamide VI (CHEBI:197916) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S,3S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[benzoyl(methyl)amino]-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]-methylamino]-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methylpentanoyl]-methylamino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 17250100 | ChemSpider |